C13H13BrN2O — CID 103809869
N-(6-bromo-3-pyridinyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 103809869) has the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(6-bromo-3-pyridinyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 103809869 |
| Molecular Formula | C13H13BrN2O |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)nc1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C13H13BrN2O/c14-12-4-3-10(7-15-12)16-13(17)11-6-8-1-2-9(11)5-8/h1-4,7-9,11H,5-6H2,(H,16,17) |
| InChIKey | AGTQNNKYHHZQME-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|