C14H13BrFNO — CID 113255457
N-(2-bromo-5-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 113255457) has the molecular formula C14H13BrFNO and a molecular weight of 310.17 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 113255457 |
| Molecular Formula | C14H13BrFNO |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1Br)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H13BrFNO/c15-12-4-3-10(16)7-13(12)17-14(18)11-6-8-1-2-9(11)5-8/h1-4,7-9,11H,5-6H2,(H,17,18) |
| InChIKey | FHTZTUINQOGRSC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|