C16H19FNO2P — CID 166380076
N-(2-dimethylphosphoryl-4-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 166380076) has the molecular formula C16H19FNO2P and a molecular weight of 307.31 g/mol. Its IUPAC name is N-(2-dimethylphosphoryl-4-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(2-dimethylphosphoryl-4-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 166380076 |
| Molecular Formula | C16H19FNO2P |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(2-dimethylphosphoryl-4-fluorophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CP(C)(=O)c1cc(F)ccc1NC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C16H19FNO2P/c1-21(2,20)15-9-12(17)5-6-14(15)18-16(19)13-8-10-3-4-11(13)7-10/h3-6,9-11,13H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | DFZDRCNOPLIMPF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|