C17H18FNOS — CID 98207008
(1R,2R,4S)-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98207008) has the molecular formula C17H18FNOS and a molecular weight of 303.40 g/mol. Its IUPAC name is (1R,2R,4S)-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98207008 |
| Molecular Formula | C17H18FNOS |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (1R,2R,4S)-N-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCSc2ccc(F)cc21)[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H18FNOS/c18-12-3-4-16-14(9-12)15(5-6-21-16)19-17(20)13-8-10-1-2-11(13)7-10/h1-4,9-11,13,15H,5-8H2,(H,19,20)/t10-,11-,13+,15+/m0/s1 |
| InChIKey | WJYUQHBMPRWSSS-HTTKSJEASA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|