C18H23FN2OS — CID 119274625
N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119274625) has the molecular formula C18H23FN2OS and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119274625 |
| Molecular Formula | C18H23FN2OS |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCSc2ccc(F)cc21)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C18H23FN2OS/c19-12-5-6-17-13(10-12)15(7-8-23-17)21-18(22)16-9-11-3-1-2-4-14(11)20-16/h5-6,10-11,14-16,20H,1-4,7-9H2,(H,21,22) |
| InChIKey | KLAULHDBALGAPY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |