C12H15N3O — CID 146085431
N-(1-methylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 146085431) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(1-methylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(1-methylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 146085431 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-(1-methylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cn1cc(NC(=O)C2CC3C=CC2C3)cn1 |
| InChI | InChI=1S/C12H15N3O/c1-15-7-10(6-13-15)14-12(16)11-5-8-2-3-9(11)4-8/h2-3,6-9,11H,4-5H2,1H3,(H,14,16) |
| InChIKey | JQLDZVTUQRHYMZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|