C8H11N3O2 — CID 175500710
(2R)-N-(1-methylpyrazol-4-yl)oxetane-2-carboxamide (PubChem CID 175500710) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is (2R)-N-(1-methylpyrazol-4-yl)oxetane-2-carboxamide.
| Compound Name | (2R)-N-(1-methylpyrazol-4-yl)oxetane-2-carboxamide |
|---|---|
| PubChem CID | 175500710 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2R)-N-(1-methylpyrazol-4-yl)oxetane-2-carboxamide |
| SMILES | Cn1cc(NC(=O)[C@H]2CCO2)cn1 |
| InChI | InChI=1S/C8H11N3O2/c1-11-5-6(4-9-11)10-8(12)7-2-3-13-7/h4-5,7H,2-3H2,1H3,(H,10,12)/t7-/m1/s1 |
| InChIKey | HXWUESHLGXMZJA-SSDOTTSWSA-N |
| XLogP | 0.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |