C10H14N4O2 — CID 71897000
1-methyl-N-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 71897000) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-methyl-N-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-methyl-N-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71897000 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-methyl-N-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)Nc2cnn(C)c2)CC1=O |
| InChI | InChI=1S/C10H14N4O2/c1-13-5-7(3-9(13)15)10(16)12-8-4-11-14(2)6-8/h4,6-7H,3,5H2,1-2H3,(H,12,16) |
| InChIKey | CJKUHJVZNLKTQY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |