C13H17N3O3S — CID 166240630
(1R,2R,4R)-N-(1-methylpyrazol-4-yl)sulfonylbicyclo[2.2.2]oct-5-ene-2-carboxamide (PubChem CID 166240630) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is (1R,2R,4R)-N-(1-methylpyrazol-4-yl)sulfonylbicyclo[2.2.2]oct-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-(1-methylpyrazol-4-yl)sulfonylbicyclo[2.2.2]oct-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 166240630 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (1R,2R,4R)-N-(1-methylpyrazol-4-yl)sulfonylbicyclo[2.2.2]oct-5-ene-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)NC(=O)[C@@H]2C[C@@H]3C=C[C@H]2CC3)cn1 |
| InChI | InChI=1S/C13H17N3O3S/c1-16-8-11(7-14-16)20(18,19)15-13(17)12-6-9-2-4-10(12)5-3-9/h2,4,7-10,12H,3,5-6H2,1H3,(H,15,17)/t9-,10+,12-/m1/s1 |
| InChIKey | MHWYVCVSNLXNJM-JFGNBEQYSA-N |
| XLogP | 0.83 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|