C23H22F3NO3 — CID 11921158
(1R,2R,4R)-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 11921158) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is (1R,2R,4R)-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 11921158 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (1R,2R,4R)-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCOc1ccc(Oc2ccc(C(F)(F)F)cc2NC(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C23H22F3NO3/c1-2-29-17-6-8-18(9-7-17)30-21-10-5-16(23(24,25)26)13-20(21)27-22(28)19-12-14-3-4-15(19)11-14/h3-10,13-15,19H,2,11-12H2,1H3,(H,27,28)/t14-,15+,19-/m1/s1 |
| InChIKey | DWSPFYJFRYMHKT-ZRGWGRIASA-N |
| XLogP | 6.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|