C26H25F3N2O4 — CID 26918034
(3R)-3-acetamido-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-phenylpropanamide (PubChem CID 26918034) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is (3R)-3-acetamido-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-phenylpropanamide.
| Compound Name | (3R)-3-acetamido-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 26918034 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (3R)-3-acetamido-N-[2-(4-ethoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-phenylpropanamide |
| SMILES | CCOc1ccc(Oc2ccc(C(F)(F)F)cc2NC(=O)C[C@@H](NC(C)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25F3N2O4/c1-3-34-20-10-12-21(13-11-20)35-24-14-9-19(26(27,28)29)15-23(24)31-25(33)16-22(30-17(2)32)18-7-5-4-6-8-18/h4-15,22H,3,16H2,1-2H3,(H,30,32)(H,31,33)/t22-/m1/s1 |
| InChIKey | VQKNESGKBPKSES-JOCHJYFZSA-N |
| XLogP | 6.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |