C18H20F2N2O — CID 98284425
(1R,2R,4S)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98284425) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is (1R,2R,4S)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98284425 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (1R,2R,4S)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(N2CCCC2)c(F)c1)[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H20F2N2O/c19-15-9-13(10-16(20)17(15)22-5-1-2-6-22)21-18(23)14-8-11-3-4-12(14)7-11/h3-4,9-12,14H,1-2,5-8H2,(H,21,23)/t11-,12-,14+/m0/s1 |
| InChIKey | WSELXBZFBBNEEL-SGMGOOAPSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|