C17H20N2O — CID 63929364
N-(1,2,3,4-tetrahydroquinolin-7-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 63929364) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-7-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-7-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 63929364 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-7-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)NCCC2)C1CC2C=CC1C2 |
| InChI | InChI=1S/C17H20N2O/c20-17(15-9-11-3-4-13(15)8-11)19-14-6-5-12-2-1-7-18-16(12)10-14/h3-6,10-11,13,15,18H,1-2,7-9H2,(H,19,20) |
| InChIKey | YCQFXVHWADIIBJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|