C17H23F2N3O3S — CID 55892029
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 55892029) has the molecular formula C17H23F2N3O3S and a molecular weight of 387.45 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55892029 |
| Molecular Formula | C17H23F2N3O3S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Nc2cc(F)c(N3CCCC3)c(F)c2)CC1 |
| InChI | InChI=1S/C17H23F2N3O3S/c1-26(24,25)22-8-4-12(5-9-22)17(23)20-13-10-14(18)16(15(19)11-13)21-6-2-3-7-21/h10-12H,2-9H2,1H3,(H,20,23) |
| InChIKey | HWEYAFLGNTUWDJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|