C25H31F2N3O3S — CID 55837185
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55837185) has the molecular formula C25H31F2N3O3S and a molecular weight of 491.60 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55837185 |
| Molecular Formula | C25H31F2N3O3S |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(C(=O)Nc3cc(F)c(N4CCCC4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C25H31F2N3O3S/c1-17(2)18-5-7-21(8-6-18)34(32,33)30-13-9-19(10-14-30)25(31)28-20-15-22(26)24(23(27)16-20)29-11-3-4-12-29/h5-8,15-17,19H,3-4,9-14H2,1-2H3,(H,28,31) |
| InChIKey | CTNGEUCUGQSASD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|