C22H29N3O6S2 — CID 4849187
N-(4-methoxy-3-sulfamoylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 4849187) has the molecular formula C22H29N3O6S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 4849187 |
| Molecular Formula | C22H29N3O6S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C(C)C)cc3)CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C22H29N3O6S2/c1-15(2)16-4-7-19(8-5-16)33(29,30)25-12-10-17(11-13-25)22(26)24-18-6-9-20(31-3)21(14-18)32(23,27)28/h4-9,14-15,17H,10-13H2,1-3H3,(H,24,26)(H2,23,27,28) |
| InChIKey | ZLLDSHWMQKCYSC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |