C19H23ClN2O3S — CID 98391439
(1R,2R,4S)-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98391439) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is (1R,2R,4S)-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98391439 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (1R,2R,4S)-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1)[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C19H23ClN2O3S/c20-17-7-6-15(21-19(23)16-11-13-4-5-14(16)10-13)12-18(17)26(24,25)22-8-2-1-3-9-22/h4-7,12-14,16H,1-3,8-11H2,(H,21,23)/t13-,14-,16+/m0/s1 |
| InChIKey | NMPGHAWOJXYKKX-OFQRWUPVSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|