C16H19ClN2O5S — CID 120974405
2-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120974405) has the molecular formula C16H19ClN2O5S and a molecular weight of 386.86 g/mol. Its IUPAC name is 2-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120974405 |
| Molecular Formula | C16H19ClN2O5S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H19ClN2O5S/c17-13-6-3-10(18-15(20)11-4-5-12(11)16(21)22)9-14(13)25(23,24)19-7-1-2-8-19/h3,6,9,11-12H,1-2,4-5,7-8H2,(H,18,20)(H,21,22) |
| InChIKey | FYSQNBNQIOIEDI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |