C14H12F6N2O — CID 108915907
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(E)-2-cyclopropylethenyl]urea (PubChem CID 108915907) has the molecular formula C14H12F6N2O and a molecular weight of 338.25 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(E)-2-cyclopropylethenyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(E)-2-cyclopropylethenyl]urea |
|---|---|
| PubChem CID | 108915907 |
| Molecular Formula | C14H12F6N2O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(E)-2-cyclopropylethenyl]urea |
| SMILES | O=C(N/C=C/C1CC1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F6N2O/c15-13(16,17)9-5-10(14(18,19)20)7-11(6-9)22-12(23)21-4-3-8-1-2-8/h3-8H,1-2H2,(H2,21,22,23)/b4-3+ |
| InChIKey | RVLOTBUVTSSWKW-ONEGZZNKSA-N |
| XLogP | 4.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |