C15H18Cl2N2O — CID 108912245
1-[(E)-2-cyclohexylethenyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 108912245) has the molecular formula C15H18Cl2N2O and a molecular weight of 313.23 g/mol. Its IUPAC name is 1-[(E)-2-cyclohexylethenyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[(E)-2-cyclohexylethenyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108912245 |
| Molecular Formula | C15H18Cl2N2O |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-[(E)-2-cyclohexylethenyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(N/C=C/C1CCCCC1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H18Cl2N2O/c16-12-8-13(17)10-14(9-12)19-15(20)18-7-6-11-4-2-1-3-5-11/h6-11H,1-5H2,(H2,18,19,20)/b7-6+ |
| InChIKey | WQHXQIIVTWGXPS-VOTSOKGWSA-N |
| XLogP | 5.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |