C17H23ClN2O2 — CID 108912284
1-(4-chloro-2-methoxy-5-methylphenyl)-3-[(E)-2-cyclohexylethenyl]urea (PubChem CID 108912284) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[(E)-2-cyclohexylethenyl]urea.
| Compound Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[(E)-2-cyclohexylethenyl]urea |
|---|---|
| PubChem CID | 108912284 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[(E)-2-cyclohexylethenyl]urea |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)N/C=C/C1CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-12-10-15(16(22-2)11-14(12)18)20-17(21)19-9-8-13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3,(H2,19,20,21)/b9-8+ |
| InChIKey | HFQIPVLLAVXADN-CMDGGOBGSA-N |
| XLogP | 4.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |