C17H23ClN2O3 — CID 108914085
1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea (PubChem CID 108914085) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea |
|---|---|
| PubChem CID | 108914085 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea |
| SMILES | COc1cc(NC(=O)N/C=C(\C)C2CCCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(12-6-4-5-7-12)10-19-17(21)20-14-9-15(22-2)13(18)8-16(14)23-3/h8-10,12H,4-7H2,1-3H3,(H2,19,20,21)/b11-10+ |
| InChIKey | MCRRWIPNLJFQPT-ZHACJKMWSA-N |
| XLogP | 4.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |