C16H21N3O2 — CID 108914030
2-[[(E)-2-cyclopentylprop-1-enyl]carbamoylamino]benzamide (PubChem CID 108914030) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[[(E)-2-cyclopentylprop-1-enyl]carbamoylamino]benzamide.
| Compound Name | 2-[[(E)-2-cyclopentylprop-1-enyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 108914030 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[[(E)-2-cyclopentylprop-1-enyl]carbamoylamino]benzamide |
| SMILES | C/C(=C\NC(=O)Nc1ccccc1C(N)=O)C1CCCC1 |
| InChI | InChI=1S/C16H21N3O2/c1-11(12-6-2-3-7-12)10-18-16(21)19-14-9-5-4-8-13(14)15(17)20/h4-5,8-10,12H,2-3,6-7H2,1H3,(H2,17,20)(H2,18,19,21)/b11-10+ |
| InChIKey | NEBZQFFDTFLFLC-ZHACJKMWSA-N |
| XLogP | 3.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |