C15H17N2O4- — CID 6920114
cis-(1R,2S)-2-[(2-carbamoylphenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 6920114) has the molecular formula C15H17N2O4- and a molecular weight of 289.31 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(2-carbamoylphenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-[(2-carbamoylphenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6920114 |
| Molecular Formula | C15H17N2O4- |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | cis-(1R,2S)-2-[(2-carbamoylphenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | NC(=O)c1ccccc1NC(=O)[C@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C15H18N2O4/c16-13(18)11-7-3-4-8-12(11)17-14(19)9-5-1-2-6-10(9)15(20)21/h3-4,7-10H,1-2,5-6H2,(H2,16,18)(H,17,19)(H,20,21)/p-1/t9-,10+/m0/s1 |
| InChIKey | LVCKPUKXIKKAOR-VHSXEESVSA-M |
| XLogP | 0.28 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |