C15H18NO4- — CID 6940396
trans-(1S,2S)-2-[(2-methoxyphenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 6940396) has the molecular formula C15H18NO4- and a molecular weight of 276.31 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(2-methoxyphenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-[(2-methoxyphenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6940396 |
| Molecular Formula | C15H18NO4- |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | trans-(1S,2S)-2-[(2-methoxyphenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | COc1ccccc1NC(=O)[C@H]1CCCC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C15H19NO4/c1-20-13-9-5-4-8-12(13)16-14(17)10-6-2-3-7-11(10)15(18)19/h4-5,8-11H,2-3,6-7H2,1H3,(H,16,17)(H,18,19)/p-1/t10-,11-/m0/s1 |
| InChIKey | XOEANOWTZYEGPB-QWRGUYRKSA-M |
| XLogP | 1.19 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |