C17H17N3O2 — CID 108907397
2-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzamide (PubChem CID 108907397) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzamide.
| Compound Name | 2-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 108907397 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzamide |
| SMILES | Cc1ccc(/C=C/NC(=O)Nc2ccccc2C(N)=O)cc1 |
| InChI | InChI=1S/C17H17N3O2/c1-12-6-8-13(9-7-12)10-11-19-17(22)20-15-5-3-2-4-14(15)16(18)21/h2-11H,1H3,(H2,18,21)(H2,19,20,22)/b11-10+ |
| InChIKey | ZTYGIYGMFBHSFJ-ZHACJKMWSA-N |
| XLogP | 2.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |