C14H19N3O — CID 108911622
1-(4-aminophenyl)-3-[(E)-2-cyclopentylethenyl]urea (PubChem CID 108911622) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[(E)-2-cyclopentylethenyl]urea.
| Compound Name | 1-(4-aminophenyl)-3-[(E)-2-cyclopentylethenyl]urea |
|---|---|
| PubChem CID | 108911622 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-(4-aminophenyl)-3-[(E)-2-cyclopentylethenyl]urea |
| SMILES | Nc1ccc(NC(=O)N/C=C/C2CCCC2)cc1 |
| InChI | InChI=1S/C14H19N3O/c15-12-5-7-13(8-6-12)17-14(18)16-10-9-11-3-1-2-4-11/h5-11H,1-4,15H2,(H2,16,17,18)/b10-9+ |
| InChIKey | CXGDDHSEJYZVFM-MDZDMXLPSA-N |
| XLogP | 3.09 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|