C15H18N2O3 — CID 108915686
ethyl 4-[[(E)-2-cyclopropylethenyl]carbamoylamino]benzoate (PubChem CID 108915686) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 4-[[(E)-2-cyclopropylethenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[(E)-2-cyclopropylethenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108915686 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | ethyl 4-[[(E)-2-cyclopropylethenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N/C=C/C2CC2)cc1 |
| InChI | InChI=1S/C15H18N2O3/c1-2-20-14(18)12-5-7-13(8-6-12)17-15(19)16-10-9-11-3-4-11/h5-11H,2-4H2,1H3,(H2,16,17,19)/b10-9+ |
| InChIKey | GILWWYFBPQJQME-MDZDMXLPSA-N |
| XLogP | 2.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |