C18H17FN2O3 — CID 108906070
ethyl 4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]benzoate (PubChem CID 108906070) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is ethyl 4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108906070 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | ethyl 4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N/C=C/c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-2-24-17(22)14-6-8-16(9-7-14)21-18(23)20-11-10-13-4-3-5-15(19)12-13/h3-12H,2H2,1H3,(H2,20,21,23)/b11-10+ |
| InChIKey | NQANKFQQBPUICD-ZHACJKMWSA-N |
| XLogP | 3.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |