C20H20FNO3 — CID 7927008
butyl 4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzoate (PubChem CID 7927008) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is butyl 4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | butyl 4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 7927008 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | butyl 4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)/C=C/c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H20FNO3/c1-2-3-13-25-20(24)16-8-10-18(11-9-16)22-19(23)12-7-15-5-4-6-17(21)14-15/h4-12,14H,2-3,13H2,1H3,(H,22,23)/b12-7+ |
| InChIKey | BZNPMRLEWJOZCE-KPKJPENVSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|