C14H18FN3O3 — CID 108906414
ethyl N-[2-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]ethyl]carbamate (PubChem CID 108906414) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is ethyl N-[2-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108906414 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl N-[2-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)N/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C14H18FN3O3/c1-2-21-14(20)18-9-8-17-13(19)16-7-6-11-4-3-5-12(15)10-11/h3-7,10H,2,8-9H2,1H3,(H,18,20)(H2,16,17,19)/b7-6+ |
| InChIKey | KEWDKESMQKEYLE-VOTSOKGWSA-N |
| XLogP | 1.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|