C17H15FN2O3 — CID 108906208
2-[4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]phenyl]acetic acid (PubChem CID 108906208) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-[4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 108906208 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[4-[[(E)-2-(3-fluorophenyl)ethenyl]carbamoylamino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)N/C=C/c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H15FN2O3/c18-14-3-1-2-12(10-14)8-9-19-17(23)20-15-6-4-13(5-7-15)11-16(21)22/h1-10H,11H2,(H,21,22)(H2,19,20,23)/b9-8+ |
| InChIKey | GNXGYOXVXTUCEF-CMDGGOBGSA-N |
| XLogP | 3.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |