C14H18N2O4S — CID 108911625
4-[[(E)-2-cyclopentylethenyl]carbamoylamino]benzenesulfonic acid (PubChem CID 108911625) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-[[(E)-2-cyclopentylethenyl]carbamoylamino]benzenesulfonic acid.
| Compound Name | 4-[[(E)-2-cyclopentylethenyl]carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108911625 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[[(E)-2-cyclopentylethenyl]carbamoylamino]benzenesulfonic acid |
| SMILES | O=C(N/C=C/C1CCCC1)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O4S/c17-14(15-10-9-11-3-1-2-4-11)16-12-5-7-13(8-6-12)21(18,19)20/h5-11H,1-4H2,(H2,15,16,17)(H,18,19,20)/b10-9+ |
| InChIKey | JZWMTIXPIOKHFK-MDZDMXLPSA-N |
| XLogP | 2.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|