C15H11F9N2O2 — CID 98423363
(3R,6S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 98423363) has the molecular formula C15H11F9N2O2 and a molecular weight of 422.25 g/mol. Its IUPAC name is (3R,6S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | (3R,6S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 98423363 |
| Molecular Formula | C15H11F9N2O2 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | (3R,6S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]1CC[C@@H](C(F)(F)F)NC1=O |
| InChI | InChI=1S/C15H11F9N2O2/c16-13(17,18)6-3-7(14(19,20)21)5-8(4-6)25-11(27)9-1-2-10(15(22,23)24)26-12(9)28/h3-5,9-10H,1-2H2,(H,25,27)(H,26,28)/t9-,10-/m0/s1 |
| InChIKey | AYXHHTXSFZZGFF-UWVGGRQHSA-N |
| XLogP | 4.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|