C14H21F3N2O2 — CID 39907738
(3S,6R)-N-(4-methylcyclohexyl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 39907738) has the molecular formula C14H21F3N2O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is (3S,6R)-N-(4-methylcyclohexyl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | (3S,6R)-N-(4-methylcyclohexyl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 39907738 |
| Molecular Formula | C14H21F3N2O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3S,6R)-N-(4-methylcyclohexyl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | CC1CCC(NC(=O)[C@@H]2CC[C@H](C(F)(F)F)NC2=O)CC1 |
| InChI | InChI=1S/C14H21F3N2O2/c1-8-2-4-9(5-3-8)18-12(20)10-6-7-11(14(15,16)17)19-13(10)21/h8-11H,2-7H2,1H3,(H,18,20)(H,19,21)/t8?,9?,10-,11+/m0/s1 |
| InChIKey | CMYGDAXJGWHZLH-WFBLGPOFSA-N |
| XLogP | 2.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|