C17H20F3N3O2 — CID 43073026
2-oxo-N-(4-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 43073026) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-oxo-N-(4-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | 2-oxo-N-(4-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43073026 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-oxo-N-(4-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C17H20F3N3O2/c18-17(19,20)14-8-7-13(16(25)22-14)15(24)21-11-3-5-12(6-4-11)23-9-1-2-10-23/h3-6,13-14H,1-2,7-10H2,(H,21,24)(H,22,25) |
| InChIKey | INTRYJSAIDYZMX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|