C20H25N3O3 — CID 91408342
(4aS,7aR)-2,4-dioxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carboxamide (PubChem CID 91408342) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (4aS,7aR)-2,4-dioxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carboxamide.
| Compound Name | (4aS,7aR)-2,4-dioxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91408342 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (4aS,7aR)-2,4-dioxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C1C(=O)N[C@@H]2CCC[C@@H]2C1=O |
| InChI | InChI=1S/C20H25N3O3/c24-18-15-5-4-6-16(15)22-20(26)17(18)19(25)21-13-7-9-14(10-8-13)23-11-2-1-3-12-23/h7-10,15-17H,1-6,11-12H2,(H,21,25)(H,22,26)/t15-,16+,17?/m0/s1 |
| InChIKey | GZTYSFZWGLMTCJ-RTKIROINSA-N |
| XLogP | 2.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|