C21H29F3N4O2 — CID 112829490
N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 112829490) has the molecular formula C21H29F3N4O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 112829490 |
| Molecular Formula | C21H29F3N4O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | CCN1CCN(Cc2ccccc2CNC(=O)C2CCC(C(F)(F)F)NC2=O)CC1 |
| InChI | InChI=1S/C21H29F3N4O2/c1-2-27-9-11-28(12-10-27)14-16-6-4-3-5-15(16)13-25-19(29)17-7-8-18(21(22,23)24)26-20(17)30/h3-6,17-18H,2,7-14H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | SNRCWMZNRPXQIT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|