C19H28F3N3O2 — CID 55715142
N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 55715142) has the molecular formula C19H28F3N3O2 and a molecular weight of 387.45 g/mol. Its IUPAC name is N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 55715142 |
| Molecular Formula | C19H28F3N3O2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCN1CCN(Cc2ccccc2CNC(=O)CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H28F3N3O2/c1-2-24-8-10-25(11-9-24)14-17-6-4-3-5-16(17)13-23-18(26)7-12-27-15-19(20,21)22/h3-6H,2,7-15H2,1H3,(H,23,26) |
| InChIKey | YURWFQSQLZAXDB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|