C24H35N5O3 — CID 55664754
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]propanamide (PubChem CID 55664754) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55664754 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]propanamide |
| SMILES | CCN1CCN(Cc2ccccc2CNC(=O)CCN2C(=O)NC3(CCCC3)C2=O)CC1 |
| InChI | InChI=1S/C24H35N5O3/c1-2-27-13-15-28(16-14-27)18-20-8-4-3-7-19(20)17-25-21(30)9-12-29-22(31)24(26-23(29)32)10-5-6-11-24/h3-4,7-8H,2,5-6,9-18H2,1H3,(H,25,30)(H,26,32) |
| InChIKey | FZDJILXSHYITBJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|