C14H25N5O3 — CID 94755207
N-(2-aminoethyl)-3-(8-ethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propanamide (PubChem CID 94755207) has the molecular formula C14H25N5O3 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(8-ethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propanamide.
| Compound Name | N-(2-aminoethyl)-3-(8-ethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propanamide |
|---|---|
| PubChem CID | 94755207 |
| Molecular Formula | C14H25N5O3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-(2-aminoethyl)-3-(8-ethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propanamide |
| SMILES | CCN1CCC2(CC1)NC(=O)N(CCC(=O)NCCN)C2=O |
| InChI | InChI=1S/C14H25N5O3/c1-2-18-9-4-14(5-10-18)12(21)19(13(22)17-14)8-3-11(20)16-7-6-15/h2-10,15H2,1H3,(H,16,20)(H,17,22) |
| InChIKey | XXBHGZJFJZBFBQ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|