C21H28N4O6S — CID 24666189
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]propanamide (PubChem CID 24666189) has the molecular formula C21H28N4O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 24666189 |
| Molecular Formula | C21H28N4O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)NCc1ccccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H28N4O6S/c26-18(7-10-25-19(27)21(23-20(25)28)8-3-4-9-21)22-15-16-5-1-2-6-17(16)32(29,30)24-11-13-31-14-12-24/h1-2,5-6H,3-4,7-15H2,(H,22,26)(H,23,28) |
| InChIKey | SFZZBEQLJPWDPO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|