C17H20F3N3O2 — CID 171904031
N-(7-methyl-1,2,3,4-tetrahydroquinolin-4-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171904031) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-(7-methyl-1,2,3,4-tetrahydroquinolin-4-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(7-methyl-1,2,3,4-tetrahydroquinolin-4-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171904031 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(7-methyl-1,2,3,4-tetrahydroquinolin-4-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc2c(c1)NCCC2NC(=O)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C17H20F3N3O2/c1-9-2-3-10-12(6-7-21-13(10)8-9)22-15(24)11-4-5-14(17(18,19)20)23-16(11)25/h2-3,8,11-12,14,21H,4-7H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | WUQFPJXXHBMUKJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|