C18H21F3N2O3 — CID 171904055
N-(2-methoxy-5-methyl-2,3-dihydro-1H-inden-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171904055) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-(2-methoxy-5-methyl-2,3-dihydro-1H-inden-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(2-methoxy-5-methyl-2,3-dihydro-1H-inden-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171904055 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-(2-methoxy-5-methyl-2,3-dihydro-1H-inden-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | COC1Cc2cc(C)ccc2C1NC(=O)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C18H21F3N2O3/c1-9-3-4-11-10(7-9)8-13(26-2)15(11)23-17(25)12-5-6-14(18(19,20)21)22-16(12)24/h3-4,7,12-15H,5-6,8H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | AOYWWGMBMJNGQU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|