C23H22F3N3O3 — CID 171903885
N-[2-(azetidin-3-yl)-9H-xanthen-9-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903885) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is N-[2-(azetidin-3-yl)-9H-xanthen-9-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(azetidin-3-yl)-9H-xanthen-9-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903885 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[2-(azetidin-3-yl)-9H-xanthen-9-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1c2ccccc2Oc2ccc(C3CNC3)cc21)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C23H22F3N3O3/c24-23(25,26)19-8-6-15(21(30)28-19)22(31)29-20-14-3-1-2-4-17(14)32-18-7-5-12(9-16(18)20)13-10-27-11-13/h1-5,7,9,13,15,19-20,27H,6,8,10-11H2,(H,28,30)(H,29,31) |
| InChIKey | QJEWUELDVFGZHA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|