C20H16F4N2O3 — CID 171903611
N-(1-fluoro-9H-xanthen-9-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903611) has the molecular formula C20H16F4N2O3 and a molecular weight of 408.35 g/mol. Its IUPAC name is N-(1-fluoro-9H-xanthen-9-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(1-fluoro-9H-xanthen-9-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903611 |
| Molecular Formula | C20H16F4N2O3 |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(1-fluoro-9H-xanthen-9-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1c2ccccc2Oc2cccc(F)c21)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C20H16F4N2O3/c21-12-5-3-7-14-16(12)17(10-4-1-2-6-13(10)29-14)26-19(28)11-8-9-15(20(22,23)24)25-18(11)27/h1-7,11,15,17H,8-9H2,(H,25,27)(H,26,28) |
| InChIKey | NULHJEDXHNJJRC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|