C23H21F3N2O3 — CID 171903894
2-oxo-N-(2-prop-2-enyl-9H-xanthen-9-yl)-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903894) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 2-oxo-N-(2-prop-2-enyl-9H-xanthen-9-yl)-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | 2-oxo-N-(2-prop-2-enyl-9H-xanthen-9-yl)-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903894 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-oxo-N-(2-prop-2-enyl-9H-xanthen-9-yl)-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | C=CCc1ccc2c(c1)C(NC(=O)C1CCC(C(F)(F)F)NC1=O)c1ccccc1O2 |
| InChI | InChI=1S/C23H21F3N2O3/c1-2-5-13-8-10-18-16(12-13)20(14-6-3-4-7-17(14)31-18)28-22(30)15-9-11-19(23(24,25)26)27-21(15)29/h2-4,6-8,10,12,15,19-20H,1,5,9,11H2,(H,27,29)(H,28,30) |
| InChIKey | SCPKDPCXGIZRQP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|