C12H18F3N3O3 — CID 120944954
N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 120944954) has the molecular formula C12H18F3N3O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 120944954 |
| Molecular Formula | C12H18F3N3O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC1CNCC1O)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C12H18F3N3O3/c13-12(14,15)9-2-1-7(11(21)18-9)10(20)17-4-6-3-16-5-8(6)19/h6-9,16,19H,1-5H2,(H,17,20)(H,18,21) |
| InChIKey | WPUZFVJGIOGUQU-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|