C25H28F3N3O2 — CID 171903661
2-oxo-N-[phenyl-(4-piperidin-4-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903661) has the molecular formula C25H28F3N3O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-oxo-N-[phenyl-(4-piperidin-4-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | 2-oxo-N-[phenyl-(4-piperidin-4-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903661 |
| Molecular Formula | C25H28F3N3O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 2-oxo-N-[phenyl-(4-piperidin-4-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc(C2CCNCC2)cc1)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C25H28F3N3O2/c26-25(27,28)21-11-10-20(23(32)30-21)24(33)31-22(18-4-2-1-3-5-18)19-8-6-16(7-9-19)17-12-14-29-15-13-17/h1-9,17,20-22,29H,10-15H2,(H,30,32)(H,31,33) |
| InChIKey | XWLZWHJJZNHHFQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|