C22H20F6N2O2 — CID 171903772
2-oxo-N-[phenyl-[4-(2,2,2-trifluoroethyl)phenyl]methyl]-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903772) has the molecular formula C22H20F6N2O2 and a molecular weight of 458.40 g/mol. Its IUPAC name is 2-oxo-N-[phenyl-[4-(2,2,2-trifluoroethyl)phenyl]methyl]-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | 2-oxo-N-[phenyl-[4-(2,2,2-trifluoroethyl)phenyl]methyl]-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903772 |
| Molecular Formula | C22H20F6N2O2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-oxo-N-[phenyl-[4-(2,2,2-trifluoroethyl)phenyl]methyl]-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc(CC(F)(F)F)cc1)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C22H20F6N2O2/c23-21(24,25)12-13-6-8-15(9-7-13)18(14-4-2-1-3-5-14)30-20(32)16-10-11-17(22(26,27)28)29-19(16)31/h1-9,16-18H,10-12H2,(H,29,31)(H,30,32) |
| InChIKey | PCUJPVJOWKALDJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|